Cost-effective and customizable 3-Chloroisoquinoline 19493-45-9 in stock We provide high quality 3-Chloroisoquinoline (CAS 19493-45-9), at a very affordable prices to our customers.

1.What is the 3-Chloroisoquinoline ?

3-Chloroisoquinoline is a chlorinated isoquinoline derivative, a chemical compound with the molecular formula C9H6ClN. It is known for its potential applications in medicinal chemistry, exhibiting biological activities such as antitumor and antimicrobial properties. This versatile compound also serves as a building block in the production of dyes and pigments, making it a significant player in the realm of organic chemistry and chemical synthesis.

Used in Pharmaceutical Synthesis:
3-Chloroisoquinoline is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Production:
3-Chloroisoquinoline also finds use in the creation of agrochemicals, contributing to the development of pesticides and other agricultural products designed to protect crops and enhance yields.
Used in Medicinal Chemistry Research:
3-Chloroisoquinoline is employed as a subject of study in medicinal chemistry, where its antitumor and antimicrobial properties are explored for potential treatments of various diseases and infections.
Used in Dye and Pigment Manufacturing:
As a building block in the production of dyes and pigments, 3-Chloroisoquinoline contributes to the coloration and enhancement of various materials in industries such as textiles, plastics, and printing inks.

2.What is the CAS number for 3-Chloroisoquinoline ?

The CAS number of 3-Chloroisoquinoline is 19493-45-9.

More information of 3-Chloroisoquinoline 19493-45-9 are:

3.What is the molecular formula of 3-Chloroisoquinoline ?

The chemical formula of?3-Chloroisoquinoline is C9H6ClN which containing 9 Carbon atoms,6 Hydrogen atoms,1 Chlorine atoms and 1 Nitrogen atoms,and the molecular weight, and the molecular weight of 3-Chloroisoquinoline is 163.606

4.What is 3-Chloroisoquinoline(19493-45-9)used for?

3-Chloroisoquinoline is a chlorinated isoquinoline derivative, a chemical compound with the molecular formula C9H6ClN. It is known for its potential applications in medicinal chemistry, exhibiting biological activities such as antitumor and antimicrobial properties. This versatile compound also serves as a building block in the production of dyes and pigments, making it a significant player in the realm of organic chemistry and chemical synthesis.

InChI:InChI=1/C9H6ClN/c10-9-5-7-3-1-2-4-8(7)6-11-9/h1-6H

Relevant articles related to 3-Chloroisoquinoline:

5.Cost-effective and customizable 3-Chloroisoquinoline 19493-45-9 in stock

Hangzhou Taiyan Trading Co., Ltd is a quality supplier of 3-Chloroisoquinoline. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 3-Chloroisoquinoline 19493-45-9.